Is cinnamic acid soluble in ethanol?
It is soluble in ethanol, methanol, petroleum ether and chloroform; it is easily soluble in benzene, ether, acetone, acetic acid, carbon disulfide and oils but insoluble in water. Cinnamic acid was first isolated as crystals from cinnamon oil by Trommsdorf in 1780.
Which of the following is the correct structure for e )- cinnamic acid?
Cinnamic acid | C9H8O2 – PubChem.
What is the molecular formula of methyl cinnamate?
C10H10O2Methyl cinnamate / Formula
What is another name for cinnamic acid?
| IUPAC Name | (E)-3-phenylprop-2-enoic acid |
|---|---|
| Alternative Names | CINNAMIC ACID TRANS-CINNAMIC ACID (E)-Cinnamic acid 3-Phenylacrylic acid trans-3-Phenylacrylic acid |
| Molecular Formula | C9H8O2 |
| Molar Mass | 148.161 g/mol |
| InChI | InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/b7-6+ |
What is the molecular weight of cinnamic acid?
148.1586 g/molCinnamic acid / Molar mass
What contains cinnamic acid?
Cinnamic acid is found in a variety of plant sources, including cinnamon bark and its products, ginseng, fruits, vegetables, honey, and whole grains such as rice, wheat bran, and cereal grains.
Is cinnamic acid a phenol?
Phenolic acids are derivatives of benzoic and cinnamic acids and are present in all cereals. These acids exhibit high antioxidant activity in vitro and thus are beneficial for human health (Kamath et al., 2004). There are two classes of phenolic acids: hydroxybenzoic acids and hydroxycinnamic acids.
What is the chemical formula for cinnamic acid?
Cinnamic acid has the formula C6H5CHCHCOOH and is an odorless white crystalline acid, which is slightly soluble in water. It has a melting point of 133 degree centigrade and a boiling point of 300 degree centigrade.
What is the standard state of cinnamic acid at 25°C?
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).?) Cinnamic acid is an organic compound with the formula C 6 H 5 CH=CHCOOH. It is a white crystalline compound that is slightly soluble in water, and freely soluble in many organic solvents.
How do you make cinnamic acid from acetate?
In 1890, Rainer Ludwig Claisen described the synthesis of ethyl cinnamate by the reaction of ethyl acetate with benzaldehyde using sodium to form the enolate of the ethyl acetate, the hydrolysis of which gives the acid. Another way of preparing cinnamic acid is by the Knoevenagel condensation reaction.
How is cinnamic acid synthesized from cinnamaldehyde?
Synthesis of cinnamic acid via the Perkin reaction. Cinnamic acid, obtained from autoxidation of cinnamaldehyde, is metabolized into sodium benzoate in the liver.