Why does stearic acid have a higher melting point than oleic acid?
Both are saturated fatty acids but stearic acid (C18) has more molecular weight than palmitic acid (C16) hence more melting point. Molecular weight increases with number of carbons and hence chain length of the fatty acid. Therefore C18 fatty acids will have more molecular weight than C16 fatty acids.
What plants are high in oleic acid?
In general, edible oils such as soybean oil, palm oil and corn oil contain about 10–40% oleic acid (Table 153.3). Among them, olive oil contains 75% oleic acid which is more than 5 times higher than safflower oil. Oleic acid is best obtained from a vegetable and a useful starting material especially.
What type of fatty acid is oleic acid?
omega-9 fatty acid
Oleic acid is an omega-9 fatty acid. It can be made by the body. It is also found in foods. Highest levels are found in olive oil and other edible oils.
What is the molecular formula for linolenic acid?
C18H30O2alpha-Linolenic acid / Formula
What is the difference between oleic and stearic acid?
The key difference between stearic acid and oleic acid is that stearic acid is a saturated compound, while oleic acid is an unsaturated compound. Stearic acid and oleic acid are organic compounds having carbon chains. These are classified as fatty acids according to their chemical structures.
Is oleic acid saturated or unsaturated?
monounsaturated fatty acid
Since there is only one double bond, oleic acid is an example of a monounsaturated fatty acid.
What is high oleic oil?
A high-oleic oil is any oil high in monounsaturated fats. Each of the aforementioned oils has a high level of monounsaturated fats but varying levels of polyunsaturated fats—the more the polyunsaturated content, the lower the shelf stability.
Is oleic acid a lipid?
In chemical terms, oleic acid is classified as a monounsaturated omega-9 fatty acid, abbreviated with a lipid number of 18:1 cis-9. It has the formula CH3(CH2)7CH=CH(CH2)7COOH. The name derives from the Latin word oleum, which means oil. It is the most common fatty acid in nature….Oleic acid.
| Names | |
|---|---|
| Related compounds | Elaidic acid |
What is the structure of oleic acid?
C18H34O2Oleic acid / Formula
What is the structure of alpha-linolenic acid?
What is oleic and linoleic acids?
Oleic acid is a typical monounsaturated fatty acid. Linoleic acid is a typical polyunsaturated fatty acid.
What is the molecular formula for oleic acid?
Oleic acid PubChem CID 445639 Structure Find Similar Structures Chemical Safety Laboratory Chemical Safety Summary (LCSS Molecular Formula C18H34O2 or C8H17CH=CH(CH2)7COOH Synonyms oleic acid 112-80-1 cis-9-Octadecenoic a
What is the stereoisomer of oleic acid?
Related compounds. The stereoisomer of oleic acid is called elaidic acid or trans-9-octadecenoic acid. These isomers have distinct physical properties and biochemical properties. Elaidic acid, the most abundant trans fatty acid in diet, appears to have an adverse effect on health.
Is oleic acid a monounsaturated fat?
Instead fatty acids like oleic acid occur as their esters, commonly triglycerides, which are the greasy materials in many natural oils. Oleic acid is the most common monounsaturated fatty acid in nature. It is found in fats (triglycerides), the phospholipids that make membranes, , cholesterol esters, and wax esters.
How is oleic acid made from stearic acid?
Production and chemical behavior. The biosynthesis of oleic acid involves the action of the enzyme stearoyl-CoA 9-desaturase acting on stearoyl-CoA. In effect, stearic acid is dehydrogenated to give the monounsaturated derivative oleic acid.